(+)-Abscisic acid
Category:
CAS:
Description:
Abscisic acid is a plant hormone, which is involved in many plant developmental processes, modulating ion homeostasis and metabolism, and inhibiting germination and seedling growth.
| CID | 5280896 |
| Deprecated CAS | 11010-88-1, 11027-12-6, 11038-32-7, 16669-24-2, 18463-18-8, 14488-90-5, 22330-12-7, 34612-56-1 |
| Synonyms | (S)-(+)-Abscisic acid |
| IUPAC Name | (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Molecular Weight | 264.32 |
| Molecular Formula | C15H20O4 |
| Canonical SMILES | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1 |
| InChIKey | JLIDBLDQVAYHNE-YKALOCIXSA-N |
| Isomeric SMILES | CC1=CC(=O)CC([C@]1(/C=C/C(=C\C(=O)O)/C)O)(C)C |
| EC Number | 244-319-5 |
| UNII | 72S9A8J5GW |
Producut details
| Formulation | 0.1-0.5%SL, 1-10%SP |
| Grade | 98%TC |
| Appearance | White to Light Yellow |
| Shelf Life | Limited shelf life, expiry date on the label |
Chemical and Physical Properties
| Purity | ≥98% by HPLC |
| Application | Plant Growth Regulators |
| Storage | RT |
| Complexity | 494 |
| Exact Mass | 264.13615911 |
| Heavy Atom Count | 19 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 2 |
| Monoisotopic Mass | 264.13615911 |
| Rotatable Bond Count | 3 |
| Topological Polar Surface Area | 74.6 |
| XLogP3 | 1.6 |
Our products are chemical reagents for research use only and are not intended for human use.
Related Products
If you have any other questions or need other size, please get a quote!
Online Inquiry