Quizalofop-p-ethyl
Category:
CAS:
Description:
Quizalofop-P-ethyl, a quinoxaline derivative, is a sort of post-emergence herbicide that might be effective in regulating annual and perennial grass weeds.
| CID | 1617113 |
| Synonyms | 2-(4-((6-chloro-2-quinoxalinyl)oxy)phenoxy)-, ethyl ester, (R)-propanoic acid; ethyl (R)-2-(4-((6-chloro-2-quinoxalinyl)oxy)phenoxy)propanoate |
| IUPAC Name | ethyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate |
| Molecular Weight | 372.80 |
| Molecular Formula | C19H17ClN2O4 |
| Canonical SMILES | CCOC(=O)C(C)OC1=CC=C(C=C1)OC2=CN=C3C=C(C=CC3=N2)Cl |
| InChI | InChI=1S/C19H17ClN2O4/c1-3-24-19(23)12(2)25-14-5-7-15(8-6-14)26-18-11-21-17-10-13(20)4-9-16(17)22-18/h4-12H,3H2,1-2H3/t12-/m1/s1 |
| InChIKey | OSUHJPCHFDQAIT-GFCCVEGCSA-N |
| Isomeric SMILES | CCOC(=O)[C@@H](C)OC1=CC=C(C=C1)OC2=CN=C3C=C(C=CC3=N2)Cl |
| EC Number | 600-119-3 |
| UNII | 1U4923B12R |
Producut details
| Formulation | 5%EC, 10%EC, 12.5%EC |
| Grade | 95%TC |
| Appearance | Powder |
| Melting Point | 84.25 °C |
| Shelf Life | As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly |
Chemical and Physical Properties
| Purity | 95% |
| Density | 1.301g/cm3 |
| Solubility | 10 mM in DMSO |
| Application | Quizalofop-P-ethyl is a sort of post-emergence herbicide that might be effective in regulating annual and perennial grass weeds. |
| Storage | RT |
| Complexity | 459 |
| Exact Mass | 372.0876847 |
| Heavy Atom Count | 26 |
| Hydrogen Bond Acceptor Count | 6 |
| Hydrogen Bond Donor Count | 0 |
| Monoisotopic Mass | 372.0876847 |
| Rotatable Bond Count | 7 |
| Topological Polar Surface Area | 70.5 |
| XLogP3 | 4.3 |
Our products are chemical reagents for research use only and are not intended for human use.
Related Products
If you have any other questions or need other size, please get a quote!
Online Inquiry
